Difference between revisions of "BUTANOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTANOL BUTANOL] == * smiles: ** CCCCO * common name: ** butan-1-ol * inchi key: ** InChIKey=LR...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTANOL BUTANOL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCO |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** butan-1-ol |
| + | * inchi key: | ||
| + | ** InChIKey=LRHPLDYGYMQRHN-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 74.122 |
* Synonym(s): | * Synonym(s): | ||
| + | ** n-butyl alcohol | ||
| + | ** n-butanol | ||
| + | ** butanol | ||
| + | ** 1-hydroxybutane | ||
| + | ** 1-butanol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12362]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-161]] |
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * CAS : 71-36-3 |
| − | {{#set: inchi key=InChIKey= | + | * DRUGBANK : DB02145 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=263 263] |
| − | {{#set: consumed by=RXN- | + | * HMDB : HMDB04327 |
| − | {{#set: reversible reaction associated=RXN- | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06142 C06142] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.258.html 258] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28885 28885] | ||
| + | * METABOLIGHTS : MTBLC28885 | ||
| + | {{#set: smiles=CCCCO}} | ||
| + | {{#set: common name=butan-1-ol}} | ||
| + | {{#set: inchi key=InChIKey=LRHPLDYGYMQRHN-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=74.122 }} | ||
| + | {{#set: common name=n-butyl alcohol|n-butanol|butanol|1-hydroxybutane|1-butanol}} | ||
| + | {{#set: consumed by=RXN-12362}} | ||
| + | {{#set: reversible reaction associated=RXN-161}} | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite BUTANOL
- smiles:
- CCCCO
- common name:
- butan-1-ol
- inchi key:
- InChIKey=LRHPLDYGYMQRHN-UHFFFAOYSA-N
- molecular weight:
- 74.122
- Synonym(s):
- n-butyl alcohol
- n-butanol
- butanol
- 1-hydroxybutane
- 1-butanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71-36-3
- DRUGBANK : DB02145
- PUBCHEM:
- HMDB : HMDB04327
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC28885
