Difference between revisions of "PWY-6525"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-35...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] ==
* smiles:
+
* taxonomic range:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-3568]
* inchi key:
+
** InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I
+
 
* common name:
 
* common name:
** glutaryl-CoA
+
** stellariose and mediose biosynthesis
* molecular weight:
+
** 876.595   
+
 
* Synonym(s):
 
* Synonym(s):
** glutaryl-coenzyme A
+
** galactosyl-oligosaccharides biosynthesis
** 4-carboxybutanoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* [[2.4.1.123-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[RXN-8032]]
+
*** [[Tiso_gene_18913]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.82-RXN 2.4.1.82-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11490 RXN-11490]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11491 RXN-11491]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11492 RXN-11492]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-3568}}
** [http://www.genome.jp/dbget-bin/www_bget?C00527 C00527]
+
{{#set: common name=stellariose and mediose biosynthesis}}
* CHEBI:
+
{{#set: common name=galactosyl-oligosaccharides biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57378 57378]
+
{{#set: reaction found=1}}
* METABOLIGHTS : MTBLC57378
+
{{#set: total reaction=5}}
* PUBCHEM:
+
{{#set: completion rate=20.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266604 45266604]
+
* HMDB : HMDB01339
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I}}
+
{{#set: common name=glutaryl-CoA}}
+
{{#set: molecular weight=876.595    }}
+
{{#set: common name=glutaryl-coenzyme A|4-carboxybutanoyl-CoA}}
+
{{#set: produced by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
{{#set: reversible reaction associated=RXN-8032}}
+

Latest revision as of 20:19, 21 March 2018

Pathway PWY-6525

  • taxonomic range:
  • common name:
    • stellariose and mediose biosynthesis
  • Synonym(s):
    • galactosyl-oligosaccharides biosynthesis

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links