Difference between revisions of "Tiso gene 19256"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_19256 == * right end position: ** 1573 * transcription direction: ** POSITIVE * left end position: ** 33 * centisome position: ** 1.3311819...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_19256 == |
| − | * | + | * right end position: |
| − | ** | + | ** 1573 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 33 |
| − | * | + | * centisome position: |
| − | ** | + | ** 1.3311819 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[2.4.2.31-RXN]] | |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** Assignment: ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=1573}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=33}} |
| − | {{#set: | + | {{#set: centisome position=1.3311819 }} |
| − | {{#set: | + | {{#set: reaction associated=2.4.2.31-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:19, 21 March 2018
Gene Tiso_gene_19256
- right end position:
- 1573
- transcription direction:
- POSITIVE
- left end position:
- 33
- centisome position:
- 1.3311819
- Synonym(s):
Reactions associated
- Reaction: 2.4.2.31-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
