Difference between revisions of "CYSTATHIONINE-BETA-SYNTHASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == * smiles: ** C=C(C1(CC(C(CC1)(C)O)O))C * inchi key: ** InChIKey=WKZWTZTZW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTATHIONINE-BETA-SYNTHASE-RXN CYSTATHIONINE-BETA-SYNTHASE-RXN] == * direction: ** REVERSIBLE * co...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTATHIONINE-BETA-SYNTHASE-RXN CYSTATHIONINE-BETA-SYNTHASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cysteine |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.22 EC-4.2.1.22] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[SER]][c] '''+''' 1 [[HOMO-CYS]][c] '''<=>''' 1 [[WATER]][c] '''+''' 1 [[L-CYSTATHIONINE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 L-serine[c] '''+''' 1 L-homocysteine[c] '''<=>''' 1 H2O[c] '''+''' 1 L-cystathionine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_7852]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_3732]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[HOMOCYSDEGR-PWY]], L-cysteine biosynthesis III (from L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-I9]], L-cysteine biosynthesis VI (from L-methionine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-I9 PWY-I9] | ||
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10112 10112] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01290 R01290] |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P32232 P32232] |
− | * | + | ** [http://www.uniprot.org/uniprot/P32582 P32582] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P35520 P35520] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9YCN5 Q9YCN5] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q12633 Q12633] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P72662 P72662] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O59701 O59701] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=cysteine}} |
− | {{#set: | + | {{#set: ec number=EC-4.2.1.22}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_7852|Tiso_gene_3732}} |
− | {{#set: | + | {{#set: in pathway=HOMOCYSDEGR-PWY|PWY-I9|PWY-801}} |
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-creinhardtii|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:20, 21 March 2018
Contents
Reaction CYSTATHIONINE-BETA-SYNTHASE-RXN
- direction:
- REVERSIBLE
- common name:
- cysteine
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 SER[c] + 1 HOMO-CYS[c] <=> 1 WATER[c] + 1 L-CYSTATHIONINE[c]
- With common name(s):
- 1 L-serine[c] + 1 L-homocysteine[c] <=> 1 H2O[c] + 1 L-cystathionine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7852
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3732
- Source: orthology-creinhardtii
Pathways
- HOMOCYSDEGR-PWY, L-cysteine biosynthesis III (from L-homocysteine): HOMOCYSDEGR-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-I9, L-cysteine biosynthesis VI (from L-methionine): PWY-I9
- 5 reactions found over 7 reactions in the full pathway
- PWY-801, L-homocysteine and L-cysteine interconversion: PWY-801
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links