Difference between revisions of "TRANS-RXN0-460"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-460 TRANS-RXN0-460] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-460 TRANS-RXN0-460] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
+
−
* common name:
+
−
** ppGpp
+
−
* molecular weight:
+
−
** 598.123   
+
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine tetraphosphate
 
−
** guanosine 5'-diphosphate,3'-diphosphate
 
−
** guanosine 3',5'-bispyrophosphate
 
−
** guanosine 3',5'-bis(diphosphate)
 
−
** guanosine 3'-diphosphate 5'-diphosphate
 
−
** magic spot
 
−
** guanosine-5',3'-tetraphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PPGPPSYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[UREA]][c] '''<=>''' 1 [[UREA]][e]
−
* [[GDPPYPHOSKIN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 urea[c] '''<=>''' 1 urea[e]
−
* [[GBDP]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13204]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB04022
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_13204}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
+
{{#set: in pathway=}}
−
* HMDB : HMDB59638
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
+
−
* BIGG : ppgpp
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
+
−
{{#set: common name=ppGpp}}
+
−
{{#set: molecular weight=598.123    }}
+
−
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
+
−
{{#set: consumed by=PPGPPSYN-RXN}}
+
−
{{#set: produced by=GDPPYPHOSKIN-RXN}}
+
−
{{#set: reversible reaction associated=GBDP}}
+

Latest revision as of 20:20, 21 March 2018

Reaction TRANS-RXN0-460

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 urea[c] <=> 1 urea[e]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRANS-RXN0-460&oldid=40979"