Difference between revisions of "Tiso gene 4754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
(Created page with "Category:Gene == Gene Tiso_gene_4754 == * right end position: ** 7247 * transcription direction: ** POSITIVE * left end position: ** 5903 * centisome position: ** 41.10437...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Gene Tiso_gene_4754 ==
−
* smiles:
+
* right end position:
−
** C(C1(C=C(C(=CC=1)O)O))=O
+
** 7247
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3,4-dihydroxybenzaldehyde
+
** 5903
−
* molecular weight:
+
* centisome position:
−
** 138.123    
+
** 41.104378    
 
* Synonym(s):
 
* Synonym(s):
−
** protocatechualdehyde
 
−
** 3,4-dihydroxybenzyl aldehyde
 
−
** rancinamycin IV
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RIBULP3EPIM-RXN]]
−
* [[RXN-8872]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[P124-PWY]]
 +
* [[CALVIN-PWY]]
 +
* [[P21-PWY]]
 +
* [[PWY-5723]]
 +
* [[PWY-1861]]
 +
* [[P122-PWY]]
 +
* [[P185-PWY]]
 +
* [[NONOXIPENT-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7247}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=5903}}
−
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
{{#set: centisome position=41.104378   }}
−
* CHEBI:
+
{{#set: reaction associated=RIBULP3EPIM-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
{{#set: pathway associated=P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P122-PWY|P185-PWY|NONOXIPENT-PWY}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
−
* HMDB : HMDB59965
+
−
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
−
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
−
{{#set: common name=3,4-dihydroxybenzaldehyde}}
+
−
{{#set: molecular weight=138.123   }}
+
−
{{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
−
{{#set: produced by=RXN-8872}}
+

Latest revision as of 19:20, 21 March 2018

Gene Tiso_gene_4754

  • right end position:
    • 7247
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5903
  • centisome position:
    • 41.104378
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4754&oldid=41018"