Difference between revisions of "PWY-6993"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * inchi...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6993 PWY-6993] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6993 PWY-6993] ==
−
* smiles:
+
* taxonomic range:
−
** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N
+
 
* common name:
 
* common name:
−
** α1,6-D mannobiose
+
** nicotine degradation II (pyrrolidine pathway)
−
* molecular weight:
+
−
** 342.299   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-mannosyl-(1->6)-D-mannose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''11''' reactions in the full pathway
−
* [[3.2.1.152-RXN]]
+
* [[RXN-646]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14341]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SUCCSEMIALDDEHYDROG-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6952]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.13.11.9-RXN 1.13.11.9-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MALEATE-ISOMERASE-RXN MALEATE-ISOMERASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11318 RXN-11318]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13076 RXN-13076]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13077 RXN-13077]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13081 RXN-13081]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13082 RXN-13082]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13088 RXN-13088]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13089 RXN-13089]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01728 C01728]
+
{{#set: common name=nicotine degradation II (pyrrolidine pathway)}}
−
* CHEMSPIDER:
+
{{#set: reaction found=2}}
−
** [http://www.chemspider.com/Chemical-Structure.388648.html 388648]
+
{{#set: total reaction=11}}
−
* CHEBI:
+
{{#set: completion rate=18.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62357 62357]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439557 439557]
+
−
{{#set: smiles=C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)}}
+
−
{{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N}}
+
−
{{#set: common name=α1,6-D mannobiose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=α-D-mannosyl-(1->6)-D-mannose}}
+
−
{{#set: produced by=3.2.1.152-RXN}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY-6993

  • taxonomic range:
  • common name:
    • nicotine degradation II (pyrrolidine pathway)
  • Synonym(s):

Reaction(s) found

2 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6993&oldid=41040"