Difference between revisions of "Tiso gene 17319"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_17319 == * Synonym(s): == Reactions associated == * Reaction: GCLDH ** Source: orthology-creinhardtii == Pathways associated == ==...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_17319 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[GCLDH]] | |
| − | + | ** Source: [[orthology-creinhardtii]] | |
| − | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=GCLDH}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Gene Tiso_gene_17319
- Synonym(s):
Reactions associated
- Reaction: GCLDH
- Source: orthology-creinhardtii
