Difference between revisions of "RXN-14959"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14959 RXN-14959] == * direction: ** LEFT-TO-RIGHT * common name: ** lipoyl_synthase_mitochondri...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14959 RXN-14959] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** lipoyl_synthase_mitochondrial |
| − | * | + | ** lipoyl_mitochondrial |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/2.8.1.8 EC-2.8.1.8] | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[a-2-oxoglutarate-dehydrogenase-E2-protei]][c] '''+''' 2 [[Sulfurated-Sulfur-Acceptors]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 2 [[Reduced-2Fe-2S-Ferredoxins]][c] '''=>''' 2 [[CH33ADO]][c] '''+''' 2 [[Oxidized-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[MET]][c] '''+''' 2 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[Oxo-glutarate-dehydrogenase-lipoyl]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 a [2-oxoglutarate-dehydrogenase E2 protein] N6-octanoyl-L-lysine[c] '''+''' 2 a sulfurated [sulfur carrier][c] '''+''' 2 S-adenosyl-L-methionine[c] '''+''' 2 a reduced [2Fe-2S] ferredoxin[c] '''=>''' 2 5'-deoxyadenosine[c] '''+''' 2 an oxidized [2Fe-2S] ferredoxin[c] '''+''' 2 L-methionine[c] '''+''' 2 an unsulfurated [sulfur carrier][c] '''+''' 1 a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_8049]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_437]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-7382]], lipoate biosynthesis and incorporation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7382 PWY-7382] | ||
| + | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=lipoyl_synthase_mitochondrial}} | |
| − | + | {{#set: common name=lipoyl_mitochondrial}} | |
| − | + | {{#set: ec number=EC-2.8.1.8}} | |
| − | + | {{#set: gene associated=Tiso_gene_8049|Tiso_gene_437}} | |
| − | + | {{#set: in pathway=PWY-7382}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Contents
Reaction RXN-14959
- direction:
- LEFT-TO-RIGHT
- common name:
- lipoyl_synthase_mitochondrial
- lipoyl_mitochondrial
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 a-2-oxoglutarate-dehydrogenase-E2-protei[c] + 2 Sulfurated-Sulfur-Acceptors[c] + 2 S-ADENOSYLMETHIONINE[c] + 2 Reduced-2Fe-2S-Ferredoxins[c] => 2 CH33ADO[c] + 2 Oxidized-2Fe-2S-Ferredoxins[c] + 2 MET[c] + 2 Unsulfurated-Sulfur-Acceptors[c] + 1 Oxo-glutarate-dehydrogenase-lipoyl[c]
- With common name(s):
- 1 a [2-oxoglutarate-dehydrogenase E2 protein] N6-octanoyl-L-lysine[c] + 2 a sulfurated [sulfur carrier][c] + 2 S-adenosyl-L-methionine[c] + 2 a reduced [2Fe-2S] ferredoxin[c] => 2 5'-deoxyadenosine[c] + 2 an oxidized [2Fe-2S] ferredoxin[c] + 2 L-methionine[c] + 2 an unsulfurated [sulfur carrier][c] + 1 a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8049
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_437
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7382, lipoate biosynthesis and incorporation (yeast): PWY-7382
- 4 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
