Difference between revisions of "PWY-5785"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == * smiles: ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5785 PWY-5785] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5785 PWY-5785] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(5Z)-tetradecenoyl-CoA
+
** di-trans,poly-cis-undecaprenyl phosphate biosynthesis
* molecular weight:
+
** 985.829   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-5-cis-tetradecenoyl-CoA
 
** 3-oxo-14:1-Δ5-CoA
 
** 3-keto-5-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14394]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-8999]]
* [[RXN-14393]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_8531]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATASE-RXN UNDECAPRENYL-DIPHOSPHATASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659295 90659295]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5785 PWY-5785]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87707 87707]
+
{{#set: common name=di-trans,poly-cis-undecaprenyl phosphate biosynthesis}}
{{#set: smiles=CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J}}
+
{{#set: total reaction=2}}
{{#set: common name=3-oxo-(5Z)-tetradecenoyl-CoA}}
+
{{#set: completion rate=50.0}}
{{#set: molecular weight=985.829    }}
+
{{#set: common name=3-oxo-5-cis-tetradecenoyl-CoA|3-oxo-14:1-Δ5-CoA|3-keto-5-cis-tetradecenoyl-CoA}}
+
{{#set: consumed by=RXN-14394}}
+
{{#set: produced by=RXN-14393}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY-5785

  • taxonomic range:
  • common name:
    • di-trans,poly-cis-undecaprenyl phosphate biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links