Difference between revisions of "PWY-5138"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138] ==
* smiles:
+
* taxonomic range:
** [CH](=O)C(O)C(O)C(O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
+
 
* common name:
 
* common name:
** aldehydo-D-ribose
+
** unsaturated, even numbered fatty acid β-oxidation
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** fatty acid β-oxidation IV (unsaturated, even number)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[ENOYL-COA-HYDRAT-RXN]]
* [[RXN-14883]]
+
** 3 associated gene(s):
* [[RXN-14882]]
+
*** [[Tiso_gene_14262]]
* [[RXN0-5305]]
+
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_6885]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHBUTYRYL-COA-EPIM-RXN OHBUTYRYL-COA-EPIM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7699 RXN-7699]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7835 RXN-7835]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5138 PWY-5138]
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014]
+
{{#set: common name=unsaturated, even numbered fatty acid β-oxidation}}
* METABOLIGHTS : MTBLC47014
+
{{#set: common name=fatty acid β-oxidation IV (unsaturated, even number)}}
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}}
+
{{#set: total reaction=5}}
{{#set: common name=aldehydo-D-ribose}}
+
{{#set: completion rate=20.0}}
{{#set: molecular weight=150.131    }}
+
{{#set: reversible reaction associated=RXN-14883|RXN-14882|RXN0-5305}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY-5138

  • taxonomic range:
  • common name:
    • unsaturated, even numbered fatty acid β-oxidation
  • Synonym(s):
    • fatty acid β-oxidation IV (unsaturated, even number)

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links