Difference between revisions of "RXN-7979"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7979 RXN-7979] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** Zea-epoxidase == Reaction For...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7979 RXN-7979] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Zea-epoxidase |
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-131]][c] '''=>''' 1 [[CPD1F-133]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] |
− | == | + | * With common name(s): |
+ | ** 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 oxygen[c] '''+''' 1 antheraxanthin[c] '''=>''' 1 violaxanthin[c] '''+''' 1 H2O[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10919]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5945]], zeaxanthin, antheraxanthin and violaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-5174]], capsanthin and capsorubin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5174 PWY-5174] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07200 R07200] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Zea-epoxidase}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_10919}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5945|PWY-5174}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:22, 21 March 2018
Contents
Reaction RXN-7979
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
- Zea-epoxidase
Reaction Formula
- With identifiers:
- 2 PROTON[c] + 2 Reduced-ferredoxins[c] + 1 OXYGEN-MOLECULE[c] + 1 CPD1F-131[c] => 1 CPD1F-133[c] + 1 WATER[c] + 2 Oxidized-ferredoxins[c]
- With common name(s):
- 2 H+[c] + 2 a reduced ferredoxin [iron-sulfur] cluster[c] + 1 oxygen[c] + 1 antheraxanthin[c] => 1 violaxanthin[c] + 1 H2O[c] + 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10919
- Source: orthology-esiliculosus
Pathways
- PWY-5945, zeaxanthin, antheraxanthin and violaxanthin interconversion: PWY-5945
- 4 reactions found over 4 reactions in the full pathway
- PWY-5174, capsanthin and capsorubin biosynthesis: PWY-5174
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: