Difference between revisions of "RXN-7979"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7979 RXN-7979] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** Zea-epoxidase == Reaction For...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7979 RXN-7979] ==
−
* smiles:
+
* direction:
−
** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FURUXTVZLHCCNA-AWEZNQCLSA-N
+
−
* common name:
+
−
** (2S)-liquiritigenin
+
−
* molecular weight:
+
−
** 256.257   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-dihydroxyflavanone
+
** Zea-epoxidase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-3221]]
+
** 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-131]][c] '''=>''' 1 [[CPD1F-133]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 oxygen[c] '''+''' 1 antheraxanthin[c] '''=>''' 1 violaxanthin[c] '''+''' 1 H2O[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10919]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5945]], zeaxanthin, antheraxanthin and violaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-5174]], capsanthin and capsorubin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5174 PWY-5174]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03601
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07200 R07200]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=114829 114829]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB29519
+
{{#set: common name=Zea-epoxidase}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_10919}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09762 C09762]
+
{{#set: in pathway=PWY-5945|PWY-5174}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.chemspider.com/Chemical-Structure.102790.html 102790]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28777 28777]
+
−
* METABOLIGHTS : MTBLC28777
+
−
{{#set: smiles=C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O)}}
+
−
{{#set: inchi key=InChIKey=FURUXTVZLHCCNA-AWEZNQCLSA-N}}
+
−
{{#set: common name=(2S)-liquiritigenin}}
+
−
{{#set: molecular weight=256.257    }}
+
−
{{#set: common name=4',7-dihydroxyflavanone}}
+
−
{{#set: produced by=RXN-3221}}
+

Latest revision as of 19:22, 21 March 2018

Reaction RXN-7979

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):
    • Zea-epoxidase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5945, zeaxanthin, antheraxanthin and violaxanthin interconversion: PWY-5945
    • 4 reactions found over 4 reactions in the full pathway
  • PWY-5174, capsanthin and capsorubin biosynthesis: PWY-5174
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7979&oldid=41159"