Difference between revisions of "RXN-13202"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] == * smiles: ** CCCCCC=CCC(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13202 RXN-13202] == * direction: ** LEFT-TO-RIGHT * common name: ** carbamoyl_phosphate_synthet...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13202 RXN-13202] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M
+
 
* common name:
 
* common name:
−
** leukotriene B4
+
** carbamoyl_phosphate_synthetase
−
* molecular weight:
+
** protein_pyr1-3
−
** 335.462   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.3.4.16 EC-6.3.4.16]
 
* Synonym(s):
 
* Synonym(s):
−
** (6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+
** 1 [[HCO3]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 2 [[ATP]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[CARBAMOYL-P]][c] '''+''' 2 [[ADP]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 hydrogencarbonate[c] '''+''' 1 ammonium[c] '''+''' 2 ATP[c] '''=>''' 2 H+[c] '''+''' 1 carbamoyl phosphate[c] '''+''' 2 ADP[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4976]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4685]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4975]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-4984]], urea cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 71160-24-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10624 10624]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615214 23615214]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18030 18030]
−
* HMDB : HMDB01085
+
* LIGAND-RXN:
−
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00149 R00149]
−
** [http://www.genome.jp/dbget-bin/www_bget?C02165 C02165]
+
* UNIPROT:
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/O15829 O15829]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57461 57461]
+
** [http://www.uniprot.org/uniprot/O15830 O15830]
−
* METABOLIGHTS : MTBLC57461
+
** [http://www.uniprot.org/uniprot/P07756 P07756]
−
{{#set: smiles=CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]}}
+
** [http://www.uniprot.org/uniprot/P31327 P31327]
−
{{#set: inchi key=InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=leukotriene B4}}
+
{{#set: common name=carbamoyl_phosphate_synthetase}}
−
{{#set: molecular weight=335.462    }}
+
{{#set: common name=protein_pyr1-3}}
−
{{#set: common name=(6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate}}
+
{{#set: ec number=EC-6.3.4.16}}
−
{{#set: produced by=LEUKOTRIENE-A4-HYDROLASE-RXN}}
+
{{#set: gene associated=Tiso_gene_4976|Tiso_gene_4685|Tiso_gene_4975}}
 +
{{#set: in pathway=PWY-4984}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:22, 21 March 2018

Reaction RXN-13202

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • carbamoyl_phosphate_synthetase
    • protein_pyr1-3
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hydrogencarbonate[c] + 1 ammonium[c] + 2 ATP[c] => 2 H+[c] + 1 carbamoyl phosphate[c] + 2 ADP[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-4984, urea cycle: PWY-4984
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13202&oldid=41213"