Difference between revisions of "Tiso gene 13392"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Gene == Gene Tiso_gene_13392 == * right end position: ** 3099 * transcription direction: ** POSITIVE * left end position: ** 1460 * centisome position: ** 23.0866...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13392 == |
− | * | + | * right end position: |
− | ** | + | ** 3099 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1460 |
− | * | + | * centisome position: |
− | ** | + | ** 23.086653 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Assignment: automated-name-match |
− | * | + | * Reaction: [[RXN-17731]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | + | == Pathways associated == | |
− | * | + | * [[PWY-7782]] |
− | + | * [[PWY4FS-6]] | |
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=3099}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1460}} | |
− | + | {{#set: centisome position=23.086653 }} | |
− | + | {{#set: reaction associated=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN|RXN-17731}} | |
− | + | {{#set: pathway associated=PWY-7782|PWY4FS-6}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:22, 21 March 2018
Gene Tiso_gene_13392
- right end position:
- 3099
- transcription direction:
- POSITIVE
- left end position:
- 1460
- centisome position:
- 23.086653
- Synonym(s):
Reactions associated
- Reaction: ETHANOLAMINEPHOSPHOTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-17731
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation