|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Pathway]] | + | [[Category:Metabolite]] |
− | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == |
− | * taxonomic range: | + | * smiles: |
− | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | + | ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3))) |
| * common name: | | * common name: |
− | ** formaldehyde assimilation III (dihydroxyacetone cycle) | + | ** myricetin |
| + | * inchi key: |
| + | ** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M |
| + | * molecular weight: |
| + | ** 317.231 |
| * Synonym(s): | | * Synonym(s): |
− | ** dihydroxyacetone cycle | + | ** myricitin |
− | ** xylulose-monophosphate cycle | + | ** cannabiscetin |
| + | ** myricetol |
| | | |
− | == Reaction(s) found == | + | == Reaction(s) known to consume the compound == |
− | '''11''' reactions found over '''12''' reactions in the full pathway
| + | == Reaction(s) known to produce the compound == |
− | * [[1TRANSKETO-RXN]]
| + | * [[RXN-8450]] |
− | ** 2 associated gene(s):
| + | == Reaction(s) of unknown directionality == |
− | *** [[Tiso_gene_5008]]
| + | |
− | *** [[Tiso_gene_11559]]
| + | |
− | ** 5 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-synechocystis]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | * [[2TRANSKETO-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_11559]]
| + | |
− | *** [[Tiso_gene_5008]]
| + | |
− | ** 5 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | * [[F16ALDOLASE-RXN]]
| + | |
− | ** 6 associated gene(s):
| + | |
− | *** [[Tiso_gene_65]]
| + | |
− | *** [[Tiso_gene_9119]]
| + | |
− | *** [[Tiso_gene_9179]]
| + | |
− | *** [[Tiso_gene_12272]]
| + | |
− | *** [[Tiso_gene_14568]]
| + | |
− | *** [[Tiso_gene_9118]]
| + | |
− | ** 5 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | * [[F16BDEPHOS-RXN]]
| + | |
− | ** 7 associated gene(s):
| + | |
− | *** [[Tiso_gene_16502]]
| + | |
− | *** [[Tiso_gene_8226]]
| + | |
− | *** [[Tiso_gene_9435]]
| + | |
− | *** [[Tiso_gene_4904]]
| + | |
− | *** [[Tiso_gene_3483]]
| + | |
− | *** [[Tiso_gene_15398]]
| + | |
− | *** [[Tiso_gene_4905]]
| + | |
− | ** 6 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | * [[GAPOXNPHOSPHN-RXN]]
| + | |
− | ** 5 associated gene(s):
| + | |
− | *** [[Tiso_gene_20000]]
| + | |
− | *** [[Tiso_gene_6766]]
| + | |
− | *** [[Tiso_gene_10646]]
| + | |
− | *** [[Tiso_gene_3344]]
| + | |
− | *** [[Tiso_gene_235]]
| + | |
− | ** 7 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[orthology-synechocystis]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | * [[GLYCERONE-KINASE-RXN]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_14441]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[PHOSGLYPHOS-RXN]]
| + | |
− | ** 6 associated gene(s):
| + | |
− | *** [[Tiso_gene_3527]]
| + | |
− | *** [[Tiso_gene_18263]]
| + | |
− | *** [[Tiso_gene_12104]]
| + | |
− | *** [[Tiso_gene_3526]]
| + | |
− | *** [[Tiso_gene_14642]]
| + | |
− | *** [[Tiso_gene_18264]]
| + | |
− | ** 7 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[orthology-synechocystis]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | * [[RIB5PISOM-RXN]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_18217]]
| + | |
− | ** 5 reconstruction source(s) associated:
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-synechocystis]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | * [[RIBULP3EPIM-RXN]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_4754]]
| + | |
− | *** [[Tiso_gene_19140]]
| + | |
− | *** [[Tiso_gene_10879]]
| + | |
− | ** 7 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[orthology-synechocystis]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | * [[TRANSALDOL-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_17601]]
| + | |
− | *** [[Tiso_gene_1831]]
| + | |
− | ** 6 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | * [[TRIOSEPISOMERIZATION-RXN]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_20000]]
| + | |
− | *** [[Tiso_gene_19961]]
| + | |
− | *** [[Tiso_gene_10646]]
| + | |
− | *** [[Tiso_gene_19962]]
| + | |
− | ** 7 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-athaliana]]
| + | |
− | *** [[orthology-synechocystis]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[orthology-creinhardtii]]
| + | |
− | == Reaction(s) not found == | + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=FORMALDEHYDE-TRANSKETOLASE-RXN FORMALDEHYDE-TRANSKETOLASE-RXN]
| + | |
| == External links == | | == External links == |
− | {{#set: taxonomic range=TAX-4751}} | + | * PUBCHEM: |
− | {{#set: common name=formaldehyde assimilation III (dihydroxyacetone cycle)}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643] |
− | {{#set: common name=dihydroxyacetone cycle|xylulose-monophosphate cycle}} | + | * HMDB : HMDB02755 |
− | {{#set: reaction found=11}} | + | * CHEBI: |
− | {{#set: total reaction=12}} | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395] |
− | {{#set: completion rate=92.0}} | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107] |
| + | {{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}} |
| + | {{#set: common name=myricetin}} |
| + | {{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}} |
| + | {{#set: molecular weight=317.231 }} |
| + | {{#set: common name=myricitin|cannabiscetin|myricetol}} |
| + | {{#set: produced by=RXN-8450}} |