Difference between revisions of "Tiso gene 18421"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * in...")
(Created page with "Category:Gene == Gene Tiso_gene_18421 == * right end position: ** 2879 * transcription direction: ** NEGATIVE * left end position: ** 934 * centisome position: ** 30.82508...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+
== Gene Tiso_gene_18421 ==
−
* smiles:
+
* right end position:
−
** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
+
** 2879
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** p-nitrophenyl-α-D-galactopyranoside
+
** 934
−
* molecular weight:
+
* centisome position:
−
** 301.252    
+
** 30.82508    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-nitrophenyl-α-D-galactopyranoside
 
−
** 4-nitrophenyl-α-D-galactoside
 
−
** p-nitrophenyl-α-D-galactoside
 
−
** pNPαGal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17830]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2879}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=934}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840]
+
{{#set: centisome position=30.82508   }}
−
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}}
+
−
{{#set: common name=p-nitrophenyl-α-D-galactopyranoside}}
+
−
{{#set: molecular weight=301.252   }}
+
−
{{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}}
+
−
{{#set: consumed by=RXN-17830}}
+

Latest revision as of 19:23, 21 March 2018

Gene Tiso_gene_18421

  • right end position:
    • 2879
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 934
  • centisome position:
    • 30.82508
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18421&oldid=41311"