Difference between revisions of "CPD-10337"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BADH-RXN BADH-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.2.1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BADH-RXN BADH-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.2.1.8 EC-1.2.1.8]
+
** chlorophyll c2
 +
* molecular weight:
 +
** 606.919   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[BETAINE_ALDEHYDE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[BETAINE]][c] '''+''' 2 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-17487]]
−
** 1 H2O[c] '''+''' 1 betaine aldehyde[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 glycine betaine[c] '''+''' 2 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3513]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[CHOLINE-BETAINE-ANA-PWY]], choline degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-BETAINE-ANA-PWY CHOLINE-BETAINE-ANA-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY1F-353]], glycine betaine biosynthesis III (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-353 PWY1F-353]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7494]], choline degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7494 PWY-7494]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[BETSYN-PWY]], glycine betaine biosynthesis I (Gram-negative bacteria): [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-3722]], glycine betaine biosynthesis II (Gram-positive bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3722 PWY-3722]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30070 30070]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244281 25244281]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15305 15305]
+
* CHEBI:
−
* LIGAND-RXN:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38203 38203]
−
** [http://www.genome.jp/dbget-bin/www_bget?R02565 R02565]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
* UNIPROT:
+
{{#set: common name=chlorophyll c2}}
−
** [http://www.uniprot.org/uniprot/P17202 P17202]
+
{{#set: molecular weight=606.919    }}
−
** [http://www.uniprot.org/uniprot/P17445 P17445]
+
{{#set: reversible reaction associated=RXN-17487}}
−
** [http://www.uniprot.org/uniprot/P28237 P28237]
+
−
** [http://www.uniprot.org/uniprot/P42757 P42757]
+
−
** [http://www.uniprot.org/uniprot/Q40024 Q40024]
+
−
** [http://www.uniprot.org/uniprot/O24174 O24174]
+
−
** [http://www.uniprot.org/uniprot/Q43828 Q43828]
+
−
** [http://www.uniprot.org/uniprot/Q43829 Q43829]
+
−
** [http://www.uniprot.org/uniprot/O22477 O22477]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: ec number=EC-1.2.1.8}}
+
−
{{#set: gene associated=Tiso_gene_3513}}
+
−
{{#set: in pathway=CHOLINE-BETAINE-ANA-PWY|PWY1F-353|PWY-7494|BETSYN-PWY|PWY-3722}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 19:23, 21 March 2018

Metabolite CPD-10337

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • chlorophyll c2
  • molecular weight:
    • 606.919
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10337&oldid=41327"