Difference between revisions of "HISTIDINAL"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2158 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * common name: ** histidinal *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == |
+ | * smiles: | ||
+ | ** C1(NC=NC=1CC([CH]=O)[N+]) | ||
+ | * common name: | ||
+ | ** histidinal | ||
+ | * inchi key: | ||
+ | ** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O | ||
+ | * molecular weight: | ||
+ | ** 140.164 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-histidinal | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[HISTALDEHYD-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[HISTOLDEHYD-RXN]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283] | ||
+ | * HMDB : HMDB12234 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929] | ||
+ | {{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}} | ||
+ | {{#set: common name=histidinal}} | ||
+ | {{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}} | ||
+ | {{#set: molecular weight=140.164 }} | ||
+ | {{#set: common name=L-histidinal}} | ||
+ | {{#set: consumed by=HISTALDEHYD-RXN}} | ||
+ | {{#set: reversible reaction associated=HISTOLDEHYD-RXN}} |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite HISTIDINAL
- smiles:
- C1(NC=NC=1CC([CH]=O)[N+])
- common name:
- histidinal
- inchi key:
- InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
- molecular weight:
- 140.164
- Synonym(s):
- L-histidinal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.