Difference between revisions of "PWY-7277"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** sphingolipid biosynthesis (mammals) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''5''' reactions found over '''7''' reactions in the full pathway |
| − | + | * [[PWY3DJ-11281]] | |
| − | + | ** 0 associated gene: | |
| − | * [[ | + | * [[PWY3DJ-12]] |
| + | ** 0 associated gene: | ||
| + | * [[RXN-12339]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-15211]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-15212]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_12644]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: common name=sphingolipid biosynthesis (mammals)}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=71.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:24, 21 March 2018
Pathway PWY-7277
- taxonomic range:
- common name:
- sphingolipid biosynthesis (mammals)
- Synonym(s):
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- PWY3DJ-11281
- 0 associated gene:
- PWY3DJ-12
- 0 associated gene:
- RXN-12339
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15211
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15212
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
