Difference between revisions of "CPD-323"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-RRNA-N2-METHYLGUANINE2445 23S-RRNA-N2-METHYLGUANINE2445] == * common name: ** an N2-methylg...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == |
| + | * smiles: | ||
| + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
* common name: | * common name: | ||
| − | ** | + | ** cholest-4-en-3-one |
| + | * inchi key: | ||
| + | ** InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N | ||
| + | * molecular weight: | ||
| + | ** 384.644 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cholestenone | ||
| + | ** 4-cholesten-3-one | ||
| + | ** 4-cholestene-3-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 601-57-0 |
| − | {{#set: | + | * LIPID_MAPS : LMST01010015 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91477 91477] | ||
| + | * HMDB : HMDB00921 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00599 C00599] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.82602.html 82602] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16175 16175] | ||
| + | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=cholest-4-en-3-one}} | ||
| + | {{#set: inchi key=InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N}} | ||
| + | {{#set: molecular weight=384.644 }} | ||
| + | {{#set: common name=cholestenone|4-cholesten-3-one|4-cholestene-3-one}} | ||
| + | {{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}} | ||
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-323
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- cholest-4-en-3-one
- inchi key:
- InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N
- molecular weight:
- 384.644
- Synonym(s):
- cholestenone
- 4-cholesten-3-one
- 4-cholestene-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 601-57-0
- LIPID_MAPS : LMST01010015
- PUBCHEM:
- HMDB : HMDB00921
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
