Difference between revisions of "S-24-DINITROPHENYLGLUTATHIONE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2350 == * Synonym(s): == Reactions associated == * 2.7.1.68-RXN ** pantograph-athaliana == Pathways associated == * PWY-6352...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * smiles: ** C(=O)([O-])CNC(=O)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1) | ||
| + | * common name: | ||
| + | ** 2,4-dinitrophenyl-S-glutathione | ||
| + | * inchi key: | ||
| + | ** InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M | ||
| + | * molecular weight: | ||
| + | ** 472.406 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** DNP-SG | ||
| + | ** S-(2,4-dinitrophenyl)glutathione | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[GST-RXN]] |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25322932 25322932] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8927 8927] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11175 C11175] | ||
| + | {{#set: smiles=C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)}} | ||
| + | {{#set: common name=2,4-dinitrophenyl-S-glutathione}} | ||
| + | {{#set: inchi key=InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M}} | ||
| + | {{#set: molecular weight=472.406 }} | ||
| + | {{#set: common name=DNP-SG|S-(2,4-dinitrophenyl)glutathione}} | ||
| + | {{#set: reversible reaction associated=GST-RXN}} | ||
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite S-24-DINITROPHENYLGLUTATHIONE
- smiles:
- C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)
- common name:
- 2,4-dinitrophenyl-S-glutathione
- inchi key:
- InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M
- molecular weight:
- 472.406
- Synonym(s):
- DNP-SG
- S-(2,4-dinitrophenyl)glutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)" cannot be used as a page name in this wiki.
