Difference between revisions of "PWY-1722"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** formate assimilation into 5,10-methylenetetrahydrofolate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | * [[ | + | * [[FORMATETHFLIG-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_432]] |
− | + | *** [[Tiso_gene_7582]] | |
− | * [[ | + | ** 4 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-experimental_annotation]] |
− | * [[ | + | *** [[manual-primary_network]] |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | == Reaction(s) | + | * [[METHENYLTHFCYCLOHYDRO-RXN]] |
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[METHYLENETHFDEHYDROG-NADP-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_6004]] | ||
+ | *** [[Tiso_gene_432]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=formate assimilation into 5,10-methylenetetrahydrofolate}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Pathway PWY-1722
- taxonomic range:
- common name:
- formate assimilation into 5,10-methylenetetrahydrofolate
- Synonym(s):
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- FORMATETHFLIG-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- METHENYLTHFCYCLOHYDRO-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- METHYLENETHFDEHYDROG-NADP-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated: