Difference between revisions of "CPD-1063"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * smiles: ** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-] * common name: ** 5-methyl...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == |
− | * | + | * smiles: |
− | ** [ | + | ** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 5-methylthioribulose 1-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L | ||
+ | * molecular weight: | ||
+ | ** 258.182 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-methylthio-5-deoxy-D-ribulose 1-phosphate | ||
+ | ** 1-phosphomethylthioribulose | ||
+ | ** methylthioribulose 1-phosphate | ||
+ | ** MTRu-1-P | ||
+ | ** 1PMT-ribulose | ||
+ | ** 1-phospho-5-S-methylthioribulose | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[M5TRPI]] | |
− | + | * [[5.3.1.23-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | + | * BIGG : 5mdru1p | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615271 23615271] |
− | {{#set: | + | * HMDB : HMDB01299 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04582 C04582] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.19951215.html 19951215] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58548 58548] | ||
+ | * METABOLIGHTS : MTBLC58548 | ||
+ | {{#set: smiles=CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]}} | ||
+ | {{#set: common name=5-methylthioribulose 1-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L}} | ||
+ | {{#set: molecular weight=258.182 }} | ||
+ | {{#set: common name=5-methylthio-5-deoxy-D-ribulose 1-phosphate|1-phosphomethylthioribulose|methylthioribulose 1-phosphate|MTRu-1-P|1PMT-ribulose|1-phospho-5-S-methylthioribulose}} | ||
+ | {{#set: produced by=M5TRPI|5.3.1.23-RXN}} |
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-1063
- smiles:
- CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]
- common name:
- 5-methylthioribulose 1-phosphate
- inchi key:
- InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L
- molecular weight:
- 258.182
- Synonym(s):
- 5-methylthio-5-deoxy-D-ribulose 1-phosphate
- 1-phosphomethylthioribulose
- methylthioribulose 1-phosphate
- MTRu-1-P
- 1PMT-ribulose
- 1-phospho-5-S-methylthioribulose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 5mdru1p
- PUBCHEM:
- HMDB : HMDB01299
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58548
"CSCC(O)C(O)C(=O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.