Difference between revisions of "METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN] == * direction: ** LEFT-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.2.16 EC-3.2.2.16] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADENINE]][c] '''+''' 1 [[CPD-560]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 S-methyl-5'-thioadenosine[c] '''+''' 1 H2O[c] '''=>''' 1 adenine[c] '''+''' 1 S-methyl-5-thio-D-ribose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12855]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY0-1391]], S-methyl-5'-thioadenosine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1391 PWY0-1391] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | * [[PWY-6754]], S-methyl-5'-thioadenosine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6754 PWY-6754] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13617 13617] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01401 R01401] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-3.2.2.16}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_12855}} |
− | {{#set: | + | {{#set: in pathway=PWY0-1391|PWY-6754}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
+ | {{#set: reconstruction source=orthology-creinhardtii}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 19:25, 21 March 2018
Contents
Reaction METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 5-METHYLTHIOADENOSINE[c] + 1 WATER[c] => 1 ADENINE[c] + 1 CPD-560[c]
- With common name(s):
- 1 S-methyl-5'-thioadenosine[c] + 1 H2O[c] => 1 adenine[c] + 1 S-methyl-5-thio-D-ribose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12855
- Source: orthology-creinhardtii
Pathways
- PWY0-1391, S-methyl-5'-thioadenosine degradation IV: PWY0-1391
- 1 reactions found over 1 reactions in the full pathway
- PWY-6754, S-methyl-5'-thioadenosine degradation I: PWY-6754
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
External links