Difference between revisions of "TCM3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCM3 TCM3] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With identifiers:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCM3 TCM3] ==
* smiles:
+
* direction:
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
+
* common name:
+
** strictosidine
+
* molecular weight:
+
** 531.581   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-α(S)-strictosidine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
** 1.0 [[PPI]][c] '''<=>''' 1.0 [[PPI]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 diphosphate[c] '''<=>''' 1.0 diphosphate[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7472]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 20824-29-7
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_7472}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
+
{{#set: reconstruction source=orthology-athaliana}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
+
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
+
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
+
{{#set: common name=strictosidine}}
+
{{#set: molecular weight=531.581    }}
+
{{#set: common name=3-&alpha;(S)-strictosidine}}
+
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Reaction TCM3

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 diphosphate[c] <=> 1.0 diphosphate[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links