Difference between revisions of "R5PDP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] == * direction: ** LEFT-TO-RIGHT * common name: ** ribose-phosphate diphosphokinase *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] ==
−
* smiles:
+
* direction:
−
** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
+
 
* common name:
 
* common name:
−
** β-D-cellobiose
+
** ribose-phosphate diphosphokinase
−
* molecular weight:
+
−
** 342.299   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-O-β-D-glucopyranosyl-β-D-glucopyranose
 
−
** β-D-glucosyl-(1→4)-β-D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10773]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[CPD-15318]][c] '''=>''' 1.0 [[PRPP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[AMP]][c]
−
* [[RXN-12305]]
+
* With common name(s):
−
* [[3.2.1.91-RXN]]
+
** 1.0 ATP[c] '''+''' 1.0 α-D-ribose 5-phosphate[c] '''=>''' 1.0 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1.0 H+[c] '''+''' 1.0 AMP[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4677]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 528-50-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=ribose-phosphate diphosphokinase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712]
+
{{#set: gene associated=Tiso_gene_4677}}
−
* HMDB : HMDB00055
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.chemspider.com/Chemical-Structure.10261.html 10261]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217]
+
−
{{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}}
+
−
{{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}}
+
−
{{#set: common name=β-D-cellobiose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}}
+
−
{{#set: consumed by=RXN-10773}}
+
−
{{#set: produced by=RXN-12305|3.2.1.91-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Reaction R5PDP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribose-phosphate diphosphokinase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 α-D-ribose 5-phosphate[c] => 1.0 5-phospho-α-D-ribose 1-diphosphate[c] + 1.0 H+[c] + 1.0 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R5PDP&oldid=41538"