Difference between revisions of "CPD-19170"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18526 == * Synonym(s): == Reactions associated == * 1.5.5.1-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** (2E,7Z)-hexadecenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J | ||
+ | * molecular weight: | ||
+ | ** 997.883 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 16:2-Δ2,Δ7-CoA | ||
+ | ** 2-trans,7-cis-hexadecenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-17779]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
+ | {{#set: common name=(2E,7Z)-hexadecenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}} | ||
+ | {{#set: molecular weight=997.883 }} | ||
+ | {{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}} | ||
+ | {{#set: produced by=RXN-17779}} |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-19170
- smiles:
- CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (2E,7Z)-hexadecenoyl-CoA
- inchi key:
- InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
- molecular weight:
- 997.883
- Synonym(s):
- 16:2-Δ2,Δ7-CoA
- 2-trans,7-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.