Difference between revisions of "BETSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TA...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY] ==
* smiles:
+
* taxonomic range:
** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
* inchi key:
+
** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
+
 
* common name:
 
* common name:
** OPC4-CoA
+
** glycine betaine biosynthesis I (Gram-negative bacteria)
* molecular weight:
+
** 983.813   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10707]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[BADH-RXN]]
* [[RXN-10700]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3513]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[CHD-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16765]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: taxonomic range=TAX-1224}}
{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
+
{{#set: common name=glycine betaine biosynthesis I (Gram-negative bacteria)}}
{{#set: common name=OPC4-CoA}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=983.813    }}
+
{{#set: total reaction=2}}
{{#set: consumed by=RXN-10707}}
+
{{#set: completion rate=100.0}}
{{#set: produced by=RXN-10700}}
+

Latest revision as of 19:26, 21 March 2018

Pathway BETSYN-PWY

  • taxonomic range:
  • common name:
    • glycine betaine biosynthesis I (Gram-negative bacteria)
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links