Difference between revisions of "CPD-17262"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6902 == * left end position: ** 943 * transcription direction: ** POSITIVE * right end position: ** 1306 * centisome position: ** 8.060518...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_6902 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] ==
* left end position:
+
* smiles:
** 943
+
** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** 3-oxo-icosatetraenoyl-CoA
* right end position:
+
* inchi key:
** 1306
+
** InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J
* centisome position:
+
* molecular weight:
** 8.060518    
+
** 1063.942    
 
* Synonym(s):
 
* Synonym(s):
 +
** (8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA
 +
** 3-oxo-eicosatetraenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-15556]]
+
* [[RXN-16020]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=943}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698357 70698357]
{{#set: right end position=1306}}
+
* CHEBI:
{{#set: centisome position=8.060518   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71491 71491]
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: pathway associated=PWY-7511}}
+
{{#set: common name=3-oxo-icosatetraenoyl-CoA}}
 +
{{#set: inchi key=InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J}}
 +
{{#set: molecular weight=1063.942   }}
 +
{{#set: common name=(8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA|3-oxo-eicosatetraenoyl-CoA}}
 +
{{#set: consumed by=RXN-16020}}

Latest revision as of 20:26, 21 March 2018

Metabolite CPD-17262

  • smiles:
    • CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-icosatetraenoyl-CoA
  • inchi key:
    • InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J
  • molecular weight:
    • 1063.942
  • Synonym(s):
    • (8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA
    • 3-oxo-eicosatetraenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.