|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BETA-LACTAMASE-RXN BETA-LACTAMASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C |
| * common name: | | * common name: |
− | ** beta-lactamase | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/3.5.2.6 EC-3.5.2.6] | + | ** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K |
| + | * molecular weight: |
| + | ** 447.424 |
| * Synonym(s): | | * Synonym(s): |
| + | ** di-trans,poly-cis-geranylgeranyl diphosphate |
| + | ** ω,E,E,Z-geranylgeranyl diphosphate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[WATER]][c] '''+''' 1 [[Beta-Lactams]][c] '''=>''' 1 [[CPD-8550]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-13323]] |
− | ** 1 H2O[c] '''+''' 1 a β-lactam[c] '''=>''' 1 a substituted β-amino acid[c]
| + | * [[RXN0-5180]] |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_19424]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_2989]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_18870]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_6745]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[annotation]] | + | |
− | ** Source: [[annotation-in-silico_annotation]] | + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R03743 R03743] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P05192 P05192]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639] |
− | ** [http://www.uniprot.org/uniprot/P14488 P14488]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P16897 P16897] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356] |
− | ** [http://www.uniprot.org/uniprot/P25910 P25910] | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}} |
− | ** [http://www.uniprot.org/uniprot/Q03680 Q03680]
| + | {{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} |
− | ** [http://www.uniprot.org/uniprot/P30896 P30896]
| + | {{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}} |
− | ** [http://www.uniprot.org/uniprot/P13661 P13661] | + | {{#set: molecular weight=447.424 }} |
− | ** [http://www.uniprot.org/uniprot/P30897 P30897] | + | {{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}} |
− | ** [http://www.uniprot.org/uniprot/P18251 P18251]
| + | {{#set: reversible reaction associated=RXN-13323|RXN0-5180}} |
− | ** [http://www.uniprot.org/uniprot/P0AD64 P0AD64]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9Z9 P0A9Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35391 P35391]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60225 Q60225]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8RT60 Q8RT60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q938A8 Q938A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q52615 Q52615]
| + | |
− | ** [http://www.uniprot.org/uniprot/P67920 P67920]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37323 P37323]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A3M1 P0A3M1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P67918 P67918]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M136 Q7M136]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83024 O83024]
| + | |
− | ** [http://www.uniprot.org/uniprot/P67919 P67919]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35392 P35392]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45460 P45460]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9F493 Q9F493]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q93CA2 Q93CA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q933M6 Q933M6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8KP20 Q8KP20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59401 Q59401]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35393 P35393]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A3M3 P0A3M3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39824 P39824]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9V2D6 Q9V2D6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PIK0 Q9PIK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q44219 Q44219]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57509 Q57509]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q45726 Q45726]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M176 Q7M176]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06650 Q06650]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q47066 Q47066]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37322 P37322]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q52152 Q52152]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10424 P10424]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00808 P00808]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06548 P06548]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00809 P00809]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04190 P04190]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A1V8 P0A1V8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62593 P62593]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05364 P05364]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00807 P00807]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14559 P14559]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00811 P00811]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18539 P18539]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10509 P10509]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q45107 Q45107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14171 P14171]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14489 P14489]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14560 P14560]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05193 P05193]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0V8 Q7M0V8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24735 P24735]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01166 Q01166]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26918 P26918]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28018 P28018]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22390 P22390]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00983 Q00983]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00982 Q00982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28585 P28585]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M175 Q7M175]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30899 P30899]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06778 Q06778]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52663 P52663]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37321 P37321]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06316 Q06316]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35695 P35695]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59398 Q59398]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22391 P22391]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52682 P52682]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46038 Q46038]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48443 Q48443]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q38058 Q38058]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59517 Q59517]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48743 Q48743]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99224 Q99224]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51899 O51899]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=beta-lactamase}} | + | |
− | {{#set: ec number=EC-3.5.2.6}}
| + | |
− | {{#set: gene associated=Tiso_gene_19424|Tiso_gene_2989|Tiso_gene_18870|Tiso_gene_6745}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |