Difference between revisions of "DGTUP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTUP DGTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** dGTP:uridine 5'-phosphotransferase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTUP DGTUP] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
+
 
* common name:
 
* common name:
−
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** dGTP:uridine 5'-phosphotransferase
−
* molecular weight:
+
−
** 447.424   
+
 
* Synonym(s):
 
* Synonym(s):
−
** di-trans,poly-cis-geranylgeranyl diphosphate
 
−
** ω,E,E,Z-geranylgeranyl diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[DGTP]][c] '''+''' 1.0 [[URIDINE]][c] '''=>''' 1.0 [[DGDP]][c] '''+''' 1.0 [[UMP]][c] '''+''' 1.0 [[PROTON]][c]
−
* [[RXN-13323]]
+
* With common name(s):
−
* [[RXN0-5180]]
+
** 1.0 dGTP[c] '''+''' 1.0 uridine[c] '''=>''' 1.0 dGDP[c] '''+''' 1.0 UMP[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
+
{{#set: common name=dGTP:uridine 5'-phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
+
−
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
−
{{#set: molecular weight=447.424    }}
+
−
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
+
−
{{#set: reversible reaction associated=RXN-13323|RXN0-5180}}
+

Latest revision as of 19:27, 21 March 2018

Reaction DGTUP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dGTP:uridine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dGTP[c] + 1.0 uridine[c] => 1.0 dGDP[c] + 1.0 UMP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DGTUP&oldid=41714"