Difference between revisions of "RIBOSE-15-BISPHOSPHATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6328 PWY-6328] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] == * smiles: ** C(C1(OC(C(C1O)O)OP([O-])([O-])=O...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** α-D-ribose 1,5-bisphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J | ||
| + | * molecular weight: | ||
| + | ** 306.059 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ribose-1,5-bisphosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN0-1401]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01151 C01151] |
| − | {{#set: | + | * HMDB : HMDB11688 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68688 68688] |
| + | * BIGG : r15bp | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678980 70678980] | ||
| + | {{#set: smiles=C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O}} | ||
| + | {{#set: common name=α-D-ribose 1,5-bisphosphate}} | ||
| + | {{#set: inchi key=InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J}} | ||
| + | {{#set: molecular weight=306.059 }} | ||
| + | {{#set: common name=ribose-1,5-bisphosphate}} | ||
| + | {{#set: consumed by=RXN0-1401}} | ||
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite RIBOSE-15-BISPHOSPHATE
- smiles:
- C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O
- common name:
- α-D-ribose 1,5-bisphosphate
- inchi key:
- InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J
- molecular weight:
- 306.059
- Synonym(s):
- ribose-1,5-bisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.
