Difference between revisions of "PWY-5317"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5317 PWY-5317] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-40...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5317 PWY-5317] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-4070]
−
* inchi key:
+
−
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
 
* common name:
 
* common name:
−
** 4α-methyl-5α-cholesta-8-en-3-one
+
** hyoscyamine and scopolamine biosynthesis
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN66-18]]
+
* [[TROPINE-DEHYDROGENASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_15179]]
 +
*** [[Tiso_gene_15180]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=6-BETA-HYDROXYHYOSCYAMINE-EPOXIDASE-RXN 6-BETA-HYDROXYHYOSCYAMINE-EPOXIDASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HYOSCYAMINE-6-DIOXYGENASE-RXN HYOSCYAMINE-6-DIOXYGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8251 RXN-8251]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8252 RXN-8252]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8253 RXN-8253]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8254 RXN-8254]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8255 RXN-8255]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4070}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
+
{{#set: common name=hyoscyamine and scopolamine biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
+
{{#set: total reaction=8}}
−
* HMDB : HMDB12174
+
{{#set: completion rate=13.0}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
−
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
−
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN66-18}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-5317

  • taxonomic range:
  • common name:
    • hyoscyamine and scopolamine biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5317&oldid=41764"