Difference between revisions of "DOPAQUINONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * common name:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dopaquinone |
| + | * inchi key: | ||
| + | ** InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 195.174 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11369]] |
| − | * [[ | + | * [[RXN-8483]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13061]] |
| − | + | * [[MONOPHENOL-MONOOXYGENASE-RXN]] | |
| − | * [[ | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00822 C00822] |
| + | * HMDB : HMDB01229 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57924 57924] |
| − | * | + | * METABOLIGHTS : MTBLC57924 |
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229226 44229226] |
| − | {{#set: | + | {{#set: smiles=C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)}} |
| − | {{#set: molecular weight= | + | {{#set: common name=dopaquinone}} |
| − | + | {{#set: inchi key=InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N}} | |
| − | {{#set: consumed by= | + | {{#set: molecular weight=195.174 }} |
| − | {{#set: produced by= | + | {{#set: consumed by=RXN-11369|RXN-8483}} |
| + | {{#set: produced by=RXN-13061|MONOPHENOL-MONOOXYGENASE-RXN}} | ||
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite DOPAQUINONE
- smiles:
- C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)
- common name:
- dopaquinone
- inchi key:
- InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N
- molecular weight:
- 195.174
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)" cannot be used as a page name in this wiki.
