|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPOXNPHOSPHN-RXN GAPOXNPHOSPHN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O |
| * common name: | | * common name: |
− | ** ORF | + | ** leukotriene-D4 |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/1.2.1.12 EC-1.2.1.12] | + | ** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M |
| + | * molecular weight: |
| + | ** 495.653 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[Pi]][c] '''+''' 1 [[GAP]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[DPG]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
| + | * [[RXN66-336]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 phosphate[c] '''+''' 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 NAD+[c] '''<=>''' 1 1,3-bisphospho-D-glycerate[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_20000]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_6766]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_10646]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_3344]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_235]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
| + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS] | + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6901]], superpathway of glucose and xylose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901]
| + | |
− | ** '''8''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[SUCSYN-PWY]], sucrose biosynthesis I (from photosynthesis): [http://metacyc.org/META/NEW-IMAGE?object=SUCSYN-PWY SUCSYN-PWY]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''11''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
| + | |
− | ** '''11''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
| + | |
− | ** '''11''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''14''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-7003]], glycerol degradation to butanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10300 10300] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265] |
− | * LIGAND-RXN: | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01061 R01061] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166] |
− | * UNIPROT:
| + | {{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}} |
− | ** [http://www.uniprot.org/uniprot/P07486 P07486]
| + | {{#set: common name=leukotriene-D4}} |
− | ** [http://www.uniprot.org/uniprot/P08477 P08477]
| + | {{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}} |
− | ** [http://www.uniprot.org/uniprot/P17878 P17878]
| + | {{#set: molecular weight=495.653 }} |
− | ** [http://www.uniprot.org/uniprot/Q01651 Q01651]
| + | {{#set: produced by=RXN66-336}} |
− | ** [http://www.uniprot.org/uniprot/Q27890 Q27890]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27820 Q27820]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M188 Q7M188]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZR1 Q7LZR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58546 Q58546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55971 P55971]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46795 P46795]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07487 P07487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01558 Q01558]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M187 Q7M187]
| + | |
− | ** [http://www.uniprot.org/uniprot/O25902 O25902]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JWT8 Q9JWT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29272 P29272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47543 P47543]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83816 O83816]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20445 P20445]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26517 P26517]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09124 P09124]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00362 P00362]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00358 P00358]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00359 P00359]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00360 P00360]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00356 P00356]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9B2 P0A9B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9B6 P0A9B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17721 P17721]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04406 P04406]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17244 P17244]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04796 P04796]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19089 P19089]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26518 P26518]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26988 P26988]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04970 P04970]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17329 P17329]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17330 P17330]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17331 P17331]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08439 P08439]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00357 P00357]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16858 P16858]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26521 P26521]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26520 P26520]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26519 P26519]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04797 P04797]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25861 P25861]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00361 P00361]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09317 P09317]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22512 P22512]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22513 P22513]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10097 P10097]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17819 P17819]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28844 P28844]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08735 P08735]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09316 P09316]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JX51 Q9JX51]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67161 O67161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44304 P44304]
| + | |
− | ** [http://www.uniprot.org/uniprot/O34425 O34425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P64178 P64178]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46450 Q46450]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50321 P50321]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50322 P50322]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34917 P34917]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34918 P34918]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07234 Q07234]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24748 P24748]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24746 P24746]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24749 P24749]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24751 P24751]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24750 P24750]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60143 Q60143]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64467 Q64467]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46406 P46406]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59800 Q59800]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80534 P80534]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UW96 Q9UW96]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32809 P32809]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32810 P32810]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20287 P20287]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35143 P35143]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25858 P25858]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10618 P10618]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M517 Q7M517]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M516 Q7M516]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09054 Q09054]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43247 Q43247]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23722 P23722]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17729 P17729]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01597 Q01597]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32637 P32637]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29497 P29497]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32638 P32638]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32635 P32635]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32636 P32636]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59309 Q59309]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34783 P34783]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00584 Q00584]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42671 Q42671]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34920 P34920]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39460 P39460]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q37265 Q37265]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q37264 Q37264]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01077 Q01077]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54270 P54270]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48335 Q48335]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43833 Q43833]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59906 Q59906]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46713 P46713]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75358 P75358]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M2K2 Q7M2K2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43359 Q43359]
| + | |
− | ** [http://www.uniprot.org/uniprot/O68075 O68075]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08060 Q08060]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49222 O49222]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34922 P34922]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04106 O04106]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49644 P49644]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32755 O32755]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34924 P34924]
| + | |
− | ** [http://www.uniprot.org/uniprot/O59841 O59841]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78958 P78958]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54118 P54118]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: ec number=EC-1.2.1.12}}
| + | |
− | {{#set: gene associated=Tiso_gene_20000|Tiso_gene_6766|Tiso_gene_10646|Tiso_gene_3344|Tiso_gene_235}} | + | |
− | {{#set: in pathway=PWY-1042|PWY66-399|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|SUCSYN-PWY|P124-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|P185-PWY|P122-PWY|PWY-7003}}
| + | |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |