Difference between revisions of "Tiso gene 20416"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_20416 == * right end position: ** 959 * transcription direction: ** POSITIVE * left end position: ** 1 * centisome position: ** 7.251631600...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Gene Tiso_gene_20416 ==
−
* smiles:
+
* right end position:
−
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 959
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
** 1
−
* molecular weight:
+
* centisome position:
−
** 987.845   
+
** 7.251631600e-2
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
 
−
** (S)-3-hydroxy-14:1-Δ5-CoA
 
−
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14393]]
+
* Reaction: [[2.1.1.109-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5956]]
 +
* [[PWY-5960]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=959}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=1}}
−
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: centisome position=7.251631600e-2}}
−
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: reaction associated=2.1.1.109-RXN|RXN-9500}}
−
{{#set: molecular weight=987.845    }}
+
{{#set: pathway associated=PWY-5956|PWY-5960}}
−
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14393}}
+

Latest revision as of 19:28, 21 March 2018

Gene Tiso_gene_20416

  • right end position:
    • 959
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1
  • centisome position:
    • 7.251631600e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20416&oldid=41857"