Difference between revisions of "Tiso gene 9290"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_9290 == * right end position: ** 6446 * transcription direction: ** NEGATIVE * left end position: ** 2856 * centisome position: ** 30.18389...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9290 == |
− | * | + | * right end position: |
− | ** | + | ** 6446 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 2856 |
− | * | + | * centisome position: |
− | ** | + | ** 30.183893 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[CDPKIN-RXN]] |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[RXN- | + | * Reaction: [[DADPKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[DCDPKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[DGDPKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[DTDPKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[DUDPKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[GDPKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[NUCLEOSIDE-DIP-KIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14120]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14228]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[UDPKIN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7210]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-7176]] | ||
+ | * [[PWY-7220]] | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7222]] | ||
+ | * [[PWY-7205]] | ||
+ | * [[PWY-7224]] | ||
+ | * [[PWY-7197]] | ||
+ | * [[PWY0-166]] | ||
+ | * [[PWY-7227]] | ||
+ | * [[PPGPPMET-PWY]] | ||
+ | * [[PWY-7226]] | ||
+ | * [[PWY-7221]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7187]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6446}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=2856}} | |
− | + | {{#set: centisome position=30.183893 }} | |
− | + | {{#set: reaction associated=CDPKIN-RXN|DADPKIN-RXN|DCDPKIN-RXN|DGDPKIN-RXN|DTDPKIN-RXN|DUDPKIN-RXN|GDPKIN-RXN|NUCLEOSIDE-DIP-KIN-RXN|RXN-14120|RXN-14228|UDPKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-7176|PWY-7220|PWY-7184|PWY-7222|PWY-7205|PWY-7224|PWY-7197|PWY0-166|PWY-7227|PPGPPMET-PWY|PWY-7226|PWY-7221|PWY-6545|PWY-7187}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:28, 21 March 2018
Gene Tiso_gene_9290
- right end position:
- 6446
- transcription direction:
- NEGATIVE
- left end position:
- 2856
- centisome position:
- 30.183893
- Synonym(s):
Reactions associated
- Reaction: CDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: DADPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: DCDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: DGDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: DTDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: DUDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: GDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: NUCLEOSIDE-DIP-KIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14120
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14228
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: UDPKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
Pathways associated
- PWY-7210
- PWY-7198
- PWY-7176
- PWY-7220
- PWY-7184
- PWY-7222
- PWY-7205
- PWY-7224
- PWY-7197
- PWY0-166
- PWY-7227
- PPGPPMET-PWY
- PWY-7226
- PWY-7221
- PWY-6545
- PWY-7187