Difference between revisions of "D-Glucopyranuronate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * smiles: ** CSCCCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=IEZWLIJBCD...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Glucopyranuronate D-Glucopyranuronate] == * common name: ** D-glucopyranuronate * Synonym(s):...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Glucopyranuronate D-Glucopyranuronate] ==
* smiles:
+
** CSCCCCCCCCC(=O)C([O-])=O
+
* inchi key:
+
** InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 10-(methylthio)-2-oxodecanoate
+
** D-glucopyranuronate
* molecular weight:
+
** 231.329   
+
 
* Synonym(s):
 
* Synonym(s):
** 10-(methylthio)-2-oxo-decanoic acid
+
** D-glucopyranuronic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLUCURONOKINASE-RXN]]
 +
* [[GLCURK]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18201]]
+
* [[BETA-GLUCURONID-RXN]]
* [[RXNQT-4178]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14693]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=D-glucopyranuronate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237295 44237295]
+
{{#set: common name=D-glucopyranuronic acid}}
* KNAPSACK : C00007651
+
{{#set: consumed by=GLUCURONOKINASE-RXN|GLCURK}}
{{#set: smiles=CSCCCCCCCCC(=O)C([O-])=O}}
+
{{#set: produced by=BETA-GLUCURONID-RXN}}
{{#set: inchi key=InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M}}
+
{{#set: reversible reaction associated=RXN-14693}}
{{#set: common name=10-(methylthio)-2-oxodecanoate}}
+
{{#set: molecular weight=231.329    }}
+
{{#set: common name=10-(methylthio)-2-oxo-decanoic acid}}
+
{{#set: produced by=RXN-18201|RXNQT-4178}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite D-Glucopyranuronate

  • common name:
    • D-glucopyranuronate
  • Synonym(s):
    • D-glucopyranuronic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links