Difference between revisions of "Tiso gene 11916"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_11916 == * Synonym(s): == Reactions associated == * Reaction: CATAL-RXN ** Source: orthology-synechocystis == Pathways associated...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] ==
+
== Gene Tiso_gene_11916 ==
* smiles:
+
** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
+
* inchi key:
+
** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
+
* common name:
+
** UDP-β-L-arabinopyranose
+
* molecular weight:
+
** 534.263   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CATAL-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-synechocystis]]
* [[UDP-ARABINOSE-4-EPIMERASE-RXN]]
+
== Pathways associated ==
 +
* [[PWY-5506]]
 +
* [[DETOX1-PWY]]
 +
* [[DETOX1-PWY-1]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=CATAL-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220]
+
{{#set: pathway associated=PWY-5506|DETOX1-PWY|DETOX1-PWY-1}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457]
+
{{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}}
+
{{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}}
+
{{#set: common name=UDP-β-L-arabinopyranose}}
+
{{#set: molecular weight=534.263    }}
+
{{#set: reversible reaction associated=UDP-ARABINOSE-4-EPIMERASE-RXN}}
+

Latest revision as of 19:29, 21 March 2018

Gene Tiso_gene_11916

  • Synonym(s):

Reactions associated

Pathways associated

External links