Difference between revisions of "4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN] == * direction:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] == * smiles: ** C1(=CC(=...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=CC(=O)OC(=CC(=O)[O-])1) |
− | * | + | * common name: |
− | ** | + | ** cis-dienelactone |
+ | * inchi key: | ||
+ | ** InChIKey=AYFXPGXAZMFWNH-ARJAWSKDSA-M | ||
+ | * molecular weight: | ||
+ | ** 139.087 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** cis-4-carboxymethylenebut-2-en-4-olide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 3374-46-7 |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543216 9543216] | |
− | + | * CHEMSPIDER: | |
− | * | + | ** [http://www.chemspider.com/Chemical-Structure.7822221.html 7822221] |
− | ** [http:// | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04431 C04431] | |
− | * | + | {{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}} |
− | ** [http://www. | + | {{#set: common name=cis-dienelactone}} |
− | + | {{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ARJAWSKDSA-M}} | |
− | * | + | {{#set: molecular weight=139.087 }} |
− | ** [http://www. | + | {{#set: common name=cis-4-carboxymethylenebut-2-en-4-olide}} |
− | {{#set: | + | {{#set: consumed by=CARBOXYMETHYLENEBUTENOLIDASE-RXN}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE
- smiles:
- C1(=CC(=O)OC(=CC(=O)[O-])1)
- common name:
- cis-dienelactone
- inchi key:
- InChIKey=AYFXPGXAZMFWNH-ARJAWSKDSA-M
- molecular weight:
- 139.087
- Synonym(s):
- cis-4-carboxymethylenebut-2-en-4-olide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=CC(=O)OC(=CC(=O)[O-])1)" cannot be used as a page name in this wiki.