Difference between revisions of "2.7.1.160-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.160-RXN 2.7.1.160-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Putative tRNA 2'-ph...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.160-RXN 2.7.1.160-RXN] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
 
* common name:
 
* common name:
** tetrahydrogeranylgeranyl chlorophyll a
+
** Putative tRNA 2'-phosphotransferase
* molecular weight:
+
* ec number:
** 890.479   
+
** [http://enzyme.expasy.org/EC/2.7.1.160 EC-2.7.1.160]
 
* Synonym(s):
 
* Synonym(s):
** tetrahydroGG-chlorophyll a
 
** tetrahydroGG-chl a
 
** tetrahydrogeranylgeranyl-chl a
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-7666]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[2-phospho-ligated-tRNA]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPD-9007]][c] '''+''' 1 [[NIACINAMIDE]][c] '''+''' 1 [[Spliced-tRNA-precursor]][c]
* [[RXN-7665]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a 2'-phospho-[ligated tRNA][c] '''+''' 1 NAD+[c] '''=>''' 1 ADP ribose 1'',2''-cyclic phosphate[c] '''+''' 1 nicotinamide[c] '''+''' 1 a spliced tRNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17372]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6689]], tRNA splicing I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: common name=Putative tRNA 2'-phosphotransferase}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: ec number=EC-2.7.1.160}}
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: gene associated=Tiso_gene_17372}}
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: in pathway=PWY-6689}}
{{#set: molecular weight=890.479    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
{{#set: consumed by=RXN-7666}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-7665}}
+

Latest revision as of 19:29, 21 March 2018

Reaction 2.7.1.160-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Putative tRNA 2'-phosphotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6689, tRNA splicing I: PWY-6689
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links