Difference between revisions of "CPD-17355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] == * smiles: ** C[N+](C)(C[CH]=O)C * inchi key: ** InChIKey=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17355 CPD-17355] == * common name: ** a [glycerolipid]-docosahexaenoate * Synonym(s): ** a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17355 CPD-17355] ==
−
* smiles:
+
−
** C[N+](C)(C[CH]=O)C
+
−
* inchi key:
+
−
** InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** betaine aldehyde
+
** a [glycerolipid]-docosahexaenoate
−
* molecular weight:
+
−
** 102.156   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glycine betaine aldehyde
+
** a [glycerolipid]-docosahexaenoic acid
−
** N,N,N-trimethyl-2-oxoethylammonium
+
** a [glycerolipid]-DHA
 +
** a [glycerolipid]-all-cis-docosa-4,7,10,13,16,19-hexaenoate
 +
** a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
 +
** a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
 +
** a docosahexaenoyl-[glycerolipid]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17758]]
+
* [[RXN-16138]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-7230]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[BADH-RXN]]
+
* [[RXN-16103]]
−
* [[CHD-RXN]]
+
−
* [[RXN-6268]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 7418-61-3
+
{{#set: common name=a [glycerolipid]-docosahexaenoate}}
−
* METABOLIGHTS : MTBLC15710
+
{{#set: common name=a [glycerolipid]-docosahexaenoic acid|a [glycerolipid]-DHA|a [glycerolipid]-all-cis-docosa-4,7,10,13,16,19-hexaenoate|a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate|a docosahexaenoyl-[glycerolipid]}}
−
* DRUGBANK : DB04401
+
{{#set: consumed by=RXN-16138}}
−
* PUBCHEM:
+
{{#set: reversible reaction associated=RXN-16103}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=249 249]
+
−
* HMDB : HMDB01252
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00576 C00576]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.244.html 244]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15710 15710]
+
−
* BIGG : betald
+
−
{{#set: smiles=C[N+](C)(C[CH]=O)C}}
+
−
{{#set: inchi key=InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N}}
+
−
{{#set: common name=betaine aldehyde}}
+
−
{{#set: molecular weight=102.156    }}
+
−
{{#set: common name=glycine betaine aldehyde|N,N,N-trimethyl-2-oxoethylammonium}}
+
−
{{#set: consumed by=RXN-17758}}
+
−
{{#set: produced by=RXN0-7230}}
+
−
{{#set: reversible reaction associated=BADH-RXN|CHD-RXN|RXN-6268}}
+

Latest revision as of 19:30, 21 March 2018

Metabolite CPD-17355

  • common name:
    • a [glycerolipid]-docosahexaenoate
  • Synonym(s):
    • a [glycerolipid]-docosahexaenoic acid
    • a [glycerolipid]-DHA
    • a [glycerolipid]-all-cis-docosa-4,7,10,13,16,19-hexaenoate
    • a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
    • a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
    • a docosahexaenoyl-[glycerolipid]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-docosahexaenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-docosahexaenoic acid" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-DHA" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-all-cis-docosa-4,7,10,13,16,19-hexaenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate" cannot be used as a page name in this wiki.
  • "a docosahexaenoyl-[glycerolipid" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17355&oldid=42085"