Difference between revisions of "CPD-19395"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACYLAMINOACYL-PEPTIDASE-RXN ACYLAMINOACYL-PEPTIDASE-RXN] == * direction: ** LEFT-TO-RIGHT * common...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * common name:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACYLAMINOACYL-PEPTIDASE-RXN ACYLAMINOACYL-PEPTIDASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
 
* common name:
 
* common name:
−
** acylamino-acid-releasing_enzyme
+
** γ-L-glutamyl-glycylglycine
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.4.19.1 EC-3.4.19.1]
+
** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
 +
* molecular weight:
 +
** 260.226   
 
* Synonym(s):
 
* Synonym(s):
 +
** γ-L-Glu-Gly-Gly
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[N-Acetyl-Peptides]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[N-Acylated-Amino-Acids]][c]
+
* [[RXN-18092]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an N-acylated peptide[c] '''+''' 1 H2O[c] '''=>''' 1 a peptide[c] '''+''' 1 H+[c] '''+''' 1 an N-acylated amino acid[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3550]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
{{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}}
−
** [http://www.uniprot.org/uniprot/P25154 P25154]
+
{{#set: common name=γ-L-glutamyl-glycylglycine}}
−
** [http://www.uniprot.org/uniprot/P39839 P39839]
+
{{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9UYB0 Q9UYB0]
+
{{#set: molecular weight=260.226    }}
−
** [http://www.uniprot.org/uniprot/P13798 P13798]
+
{{#set: common name=γ-L-Glu-Gly-Gly}}
−
** [http://www.uniprot.org/uniprot/P19205 P19205]
+
{{#set: produced by=RXN-18092}}
−
** [http://www.uniprot.org/uniprot/Q7M326 Q7M326]
+
−
** [http://www.uniprot.org/uniprot/P13676 P13676]
+
−
** [http://www.uniprot.org/uniprot/P80227 P80227]
+
−
** [http://www.uniprot.org/uniprot/P95915 P95915]
+
−
** [http://www.uniprot.org/uniprot/O13479 O13479]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=acylamino-acid-releasing_enzyme}}
+
−
{{#set: ec number=EC-3.4.19.1}}
+
−
{{#set: gene associated=Tiso_gene_3550}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:31, 21 March 2018

Metabolite CPD-19395

  • smiles:
    • C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
  • common name:
    • γ-L-glutamyl-glycylglycine
  • inchi key:
    • InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
  • molecular weight:
    • 260.226
  • Synonym(s):
    • γ-L-Glu-Gly-Gly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19395&oldid=42103"