Difference between revisions of "RXN-15066"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15066 RXN-15066] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15066 RXN-15066] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
−
* common name:
+
−
** phenylacetyl-CoA
+
−
* molecular weight:
+
−
** 881.637   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phenylacetate-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10821]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PALMITYL-COA]][c] '''+''' 1 [[CPD-8343]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 palmitoyl-CoA[c] '''+''' 1 1-16:0-2-lysophosphatidylcholine[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 1,2-dipalmitoyl-phosphatidylcholine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10604]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7416]], phospholipid remodeling (phosphatidylcholine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : phaccoa
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.23}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266611 45266611]
+
{{#set: gene associated=Tiso_gene_10604}}
−
* HMDB : HMDB06503
+
{{#set: in pathway=PWY-7416}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00582 C00582]
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57390 57390]
+
−
* METABOLIGHTS : MTBLC57390
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J}}
+
−
{{#set: common name=phenylacetyl-CoA}}
+
−
{{#set: molecular weight=881.637    }}
+
−
{{#set: common name=phenylacetate-CoA}}
+
−
{{#set: consumed by=RXN-10821}}
+

Latest revision as of 19:31, 21 March 2018

Reaction RXN-15066

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7416, phospholipid remodeling (phosphatidylcholine, yeast): PWY-7416
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15066&oldid=42104"