Difference between revisions of "ASCORBATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOCYL-TRNA-HYDROLASE-RXN AMINOCYL-TRNA-HYDROLASE-RXN] == * direction: ** LEFT-TO-RIGHT * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * common name: ** L-asc...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) |
* common name: | * common name: | ||
− | ** | + | ** L-ascorbate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M |
+ | * molecular weight: | ||
+ | ** 175.118 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-ascorbic acid | ||
+ | ** ascorbate | ||
+ | ** vitamin C | ||
+ | ** ascorbic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-12440]] |
− | + | * [[RXN-3521]] | |
− | * | + | * [[RXN-10981]] |
− | + | * [[RXN-7984]] | |
− | + | * [[RXN-7985]] | |
− | + | * [[PEPTIDYLGLYCINE-MONOOXYGENASE-RXN]] | |
− | + | * [[RXN-12876]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-3523]] | |
− | + | * [[1.6.5.4-RXN]] | |
− | + | * [[RXN-12440]] | |
− | * [[ | + | * [[GALACTONOLACTONE-DEHYDROGENASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-13185]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 50-81-7 |
− | ** | + | * BIGG : ascb__L |
− | ** [http:// | + | * PUBCHEM: |
− | ** | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54679076 54679076] |
− | ** [http://www. | + | * KNAPSACK : C00001179 |
− | ** [http://www. | + | * HMDB : HMDB00044 |
− | ** [http://www. | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00072 C00072] |
− | {{#set: common name= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.102746.html 102746] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38290 38290] |
− | {{#set: | + | * METABOLIGHTS : MTBLC38290 |
− | {{#set: | + | {{#set: smiles=C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)}} |
− | {{#set: | + | {{#set: common name=L-ascorbate}} |
+ | {{#set: inchi key=InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M}} | ||
+ | {{#set: molecular weight=175.118 }} | ||
+ | {{#set: common name=L-ascorbic acid|ascorbate|vitamin C|ascorbic acid}} | ||
+ | {{#set: consumed by=RXN-12440|RXN-3521|RXN-10981|RXN-7984|RXN-7985|PEPTIDYLGLYCINE-MONOOXYGENASE-RXN|RXN-12876}} | ||
+ | {{#set: produced by=RXN-3523|1.6.5.4-RXN|RXN-12440|GALACTONOLACTONE-DEHYDROGENASE-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-13185}} |
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite ASCORBATE
- smiles:
- C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)
- common name:
- L-ascorbate
- inchi key:
- InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M
- molecular weight:
- 175.118
- Synonym(s):
- L-ascorbic acid
- ascorbate
- vitamin C
- ascorbic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-81-7
- BIGG : ascb__L
- PUBCHEM:
- KNAPSACK : C00001179
- HMDB : HMDB00044
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC38290
"C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)" cannot be used as a page name in this wiki.