Difference between revisions of "CPD-14926"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3056 == * left end position: ** 9014 * transcription direction: ** POSITIVE * right end position: ** 11216 * centisome position: ** 51.1432...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * common name: ** phyte...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O |
| − | * | + | * common name: |
| − | ** | + | ** phytenal |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 294.52 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2E-phytenal | ||
| + | ** 3,7,11,15-tetramethyl-2E-hexadecenal | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-479]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-478]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR0104010025 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764] |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}} |
| − | {{#set: | + | {{#set: common name=phytenal}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}} |
| + | {{#set: molecular weight=294.52 }} | ||
| + | {{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}} | ||
| + | {{#set: consumed by=RXN66-479}} | ||
| + | {{#set: produced by=RXN66-478}} | ||
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite CPD-14926
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
- common name:
- phytenal
- inchi key:
- InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
- molecular weight:
- 294.52
- Synonym(s):
- 2E-phytenal
- 3,7,11,15-tetramethyl-2E-hexadecenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR0104010025
- PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O" cannot be used as a page name in this wiki.
