Difference between revisions of "CPD-19169"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-(9Z)-octadecenoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1041.936 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-oxo-18:1-Δ9-CoA |
| − | ** 3 | + | ** 3-oxo-9-cis-octadecenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17778]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17777]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}} | |
| − | + | {{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}} | |
| − | {{#set: smiles=CC( | + | {{#set: molecular weight=1041.936 }} |
| − | {{#set: | + | {{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17778}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-17777}} |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite CPD-19169
- smiles:
- CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-(9Z)-octadecenoyl-CoA
- inchi key:
- InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
- molecular weight:
- 1041.936
- Synonym(s):
- 3-oxo-18:1-Δ9-CoA
- 3-oxo-9-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
