Difference between revisions of "Tiso gene 892"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
(Created page with "Category:Gene == Gene Tiso_gene_892 == * right end position: ** 16882 * transcription direction: ** POSITIVE * left end position: ** 13832 * centisome position: ** 39.3222...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Gene Tiso_gene_892 ==
−
* smiles:
+
* right end position:
−
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
+
** 16882
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** thyroxine sulfate
+
** 13832
−
* molecular weight:
+
* centisome position:
−
** 855.924    
+
** 39.322266    
 
* Synonym(s):
 
* Synonym(s):
−
** T4 sulfate
 
−
** thyroxine-4-sulfate
 
−
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.3.46-RXN]]
−
* [[RXN-10614]]
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY66-423]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=16882}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=13832}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
+
{{#set: centisome position=39.322266   }}
−
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
+
{{#set: reaction associated=3.1.3.46-RXN|6-PHOSPHOFRUCTO-2-KINASE-RXN}}
−
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
+
{{#set: pathway associated=PWY66-423}}
−
{{#set: common name=thyroxine sulfate}}
+
−
{{#set: molecular weight=855.924   }}
+
−
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
+
−
{{#set: produced by=RXN-10614}}
+

Latest revision as of 19:31, 21 March 2018

Gene Tiso_gene_892

  • right end position:
    • 16882
  • transcription direction:
    • POSITIVE
  • left end position:
    • 13832
  • centisome position:
    • 39.322266
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_892&oldid=42184"