Difference between revisions of "CPD-724"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISPH2-RXN ISPH2-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISPH2-RXN ISPH2-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** ORF
+
** 6α-hydroxy-castasterone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.17.7.4 EC-1.17.7.4]
+
** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
 +
* molecular weight:
 +
** 466.7  
 
* Synonym(s):
 
* Synonym(s):
 +
** hydroxydeoxocastasterone
 +
** 6α-hydroxy-6-deoxocastasterone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-779]]
−
** 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-778]]
−
** 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 isopentenyl diphosphate[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5609]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08209 R08209]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699]
−
** [http://www.genome.jp/dbget-bin/www_bget?R05884 R05884]
+
* CHEBI:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760]
−
{{#set: common name=ORF}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.17.7.4}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803]
−
{{#set: gene associated=Tiso_gene_5609}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
−
{{#set: in pathway=NONMEVIPP-PWY|PWY-7560}}
+
{{#set: common name=6α-hydroxy-castasterone}}
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
{{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}}
−
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
+
{{#set: molecular weight=466.7    }}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}}
 +
{{#set: consumed by=RXN-779}}
 +
{{#set: produced by=RXN-778}}

Latest revision as of 19:32, 21 March 2018

Metabolite CPD-724

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6α-hydroxy-castasterone
  • inchi key:
    • InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
  • molecular weight:
    • 466.7
  • Synonym(s):
    • hydroxydeoxocastasterone
    • 6α-hydroxy-6-deoxocastasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-724&oldid=42200"