Difference between revisions of "CPDQT-41"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] == * direction: ** LEFT-TO-RIGHT * common name: ** ribose-phosphate diphosphokinase *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * smiles: ** CSCCCCCCCCC(=O)C([O-])=O * common name: ** 10-(methylthio)-2...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCCCCC(=O)C([O-])=O
 
* common name:
 
* common name:
−
** ribose-phosphate diphosphokinase
+
** 10-(methylthio)-2-oxodecanoate
 +
* inchi key:
 +
** InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 231.329   
 
* Synonym(s):
 
* Synonym(s):
 +
** 10-(methylthio)-2-oxo-decanoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CPD-15318]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PRPP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[AMP]][c]
+
* [[RXN-18201]]
−
* With common name(s):
+
* [[RXNQT-4178]]
−
** 1.0 α-D-ribose 5-phosphate[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1.0 H+[c] '''+''' 1.0 AMP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4677]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ribose-phosphate diphosphokinase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237295 44237295]
−
{{#set: gene associated=Tiso_gene_4677}}
+
* KNAPSACK : C00007651
−
{{#set: in pathway=}}
+
{{#set: smiles=CSCCCCCCCCC(=O)C([O-])=O}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=10-(methylthio)-2-oxodecanoate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: molecular weight=231.329    }}
 +
{{#set: common name=10-(methylthio)-2-oxo-decanoic acid}}
 +
{{#set: produced by=RXN-18201|RXNQT-4178}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPDQT-41

  • smiles:
    • CSCCCCCCCCC(=O)C([O-])=O
  • common name:
    • 10-(methylthio)-2-oxodecanoate
  • inchi key:
    • InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
  • molecular weight:
    • 231.329
  • Synonym(s):
    • 10-(methylthio)-2-oxo-decanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007651
"CSCCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPDQT-41&oldid=41584"